About methyl 8-bromo-9-oxodecanoate
methyl 8-bromo-9-oxodecanoate (PubChem CID 13099192) has the molecular formula C11H19BrO3
and a molecular weight of 279.17 g/mol. Its IUPAC name is methyl 8-bromo-9-oxodecanoate.
Molecular Properties
| Compound Name | methyl 8-bromo-9-oxodecanoate |
| PubChem CID | 13099192 |
| Molecular Formula | C11H19BrO3 |
| Molecular Weight | 279.17 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | methyl 8-bromo-9-oxodecanoate |
| SMILES | COC(=O)CCCCCCC(Br)C(C)=O |
| InChI | InChI=1S/C11H19BrO3/c1-9(13)10(12)7-5-3-4-6-8-11(14)15-2/h10H,3-8H2,1-2H3 |
| InChIKey | QYVGRDGIQSWYGX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.17 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze methyl 8-bromo-9-oxodecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 8-bromo-9-oxodecanoate?
The IUPAC name of methyl 8-bromo-9-oxodecanoate (CID 13099192) is methyl 8-bromo-9-oxodecanoate.
What is the SMILES notation for methyl 8-bromo-9-oxodecanoate?
The canonical SMILES for methyl 8-bromo-9-oxodecanoate is COC(=O)CCCCCCC(Br)C(C)=O.
What is the InChIKey of methyl 8-bromo-9-oxodecanoate?
The InChIKey is QYVGRDGIQSWYGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19BrO3/c1-9(13)10(12)7-5-3-4-6-8-11(14)15-2/h10H,3-8H2,1-2H3.
What are the key properties of methyl 8-bromo-9-oxodecanoate?
methyl 8-bromo-9-oxodecanoate has a molecular weight of 279.17 g/mol, XLogP of 2.85, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 8-bromo-9-oxodecanoate is sourced from PubChem (CID 13099192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).