C16H10F3NO3 — CID 13099449
(2,2,2-trifluoro-1-isocyanato-1-phenylethyl) benzoate (PubChem CID 13099449) has the molecular formula C16H10F3NO3 and a molecular weight of 321.25 g/mol. Its IUPAC name is (2,2,2-trifluoro-1-isocyanato-1-phenylethyl) benzoate.
| Compound Name | (2,2,2-trifluoro-1-isocyanato-1-phenylethyl) benzoate |
|---|---|
| PubChem CID | 13099449 |
| Molecular Formula | C16H10F3NO3 |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | (2,2,2-trifluoro-1-isocyanato-1-phenylethyl) benzoate |
| SMILES | O=C=NC(OC(=O)c1ccccc1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H10F3NO3/c17-16(18,19)15(20-11-21,13-9-5-2-6-10-13)23-14(22)12-7-3-1-4-8-12/h1-10H |
| InChIKey | NYTGTYMLBNZRIR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|