C8H11N5 — CID 131000566
6-(2-aminopropylamino)pyridazine-4-carbonitrile (PubChem CID 131000566) has the molecular formula C8H11N5 and a molecular weight of 177.21 g/mol. Its IUPAC name is 6-(2-aminopropylamino)pyridazine-4-carbonitrile.
| Compound Name | 6-(2-aminopropylamino)pyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 131000566 |
| Molecular Formula | C8H11N5 |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 6-(2-aminopropylamino)pyridazine-4-carbonitrile |
| SMILES | CC(N)CNc1cc(C#N)cnn1 |
| InChI | InChI=1S/C8H11N5/c1-6(10)4-11-8-2-7(3-9)5-12-13-8/h2,5-6H,4,10H2,1H3,(H,11,13) |
| InChIKey | OFQCUZIDHXOVME-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |