C10H16FNO2 — CID 131000863
(2-fluoro-1-methylcyclopropyl)-(4-hydroxy-2-methylpyrrolidin-1-yl)methanone (PubChem CID 131000863) has the molecular formula C10H16FNO2 and a molecular weight of 201.24 g/mol. Its IUPAC name is (2-fluoro-1-methylcyclopropyl)-(4-hydroxy-2-methylpyrrolidin-1-yl)methanone.
| Compound Name | (2-fluoro-1-methylcyclopropyl)-(4-hydroxy-2-methylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 131000863 |
| Molecular Formula | C10H16FNO2 |
| Molecular Weight | 201.24 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | (2-fluoro-1-methylcyclopropyl)-(4-hydroxy-2-methylpyrrolidin-1-yl)methanone |
| SMILES | CC1CC(O)CN1C(=O)C1(C)CC1F |
| InChI | InChI=1S/C10H16FNO2/c1-6-3-7(13)5-12(6)9(14)10(2)4-8(10)11/h6-8,13H,3-5H2,1-2H3 |
| InChIKey | ZJSKPLWXVBOSNB-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.24 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |