C11H16N2O — CID 131002490
4-[(3,4-dimethylpyrrol-1-yl)methyl]pyrrolidin-2-one (PubChem CID 131002490) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 4-[(3,4-dimethylpyrrol-1-yl)methyl]pyrrolidin-2-one.
| Compound Name | 4-[(3,4-dimethylpyrrol-1-yl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 131002490 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 4-[(3,4-dimethylpyrrol-1-yl)methyl]pyrrolidin-2-one |
| SMILES | Cc1cn(CC2CNC(=O)C2)cc1C |
| InChI | InChI=1S/C11H16N2O/c1-8-5-13(6-9(8)2)7-10-3-11(14)12-4-10/h5-6,10H,3-4,7H2,1-2H3,(H,12,14) |
| InChIKey | LHBZPVQSESCSBR-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |