About (3S,4S)-4-methyl-N-(3-methylcyclobutyl)-1,1-dioxothiolan-3-amine
(3S,4S)-4-methyl-N-(3-methylcyclobutyl)-1,1-dioxothiolan-3-amine (PubChem CID 131002770) has the molecular formula C10H19NO2S
and a molecular weight of 217.33 g/mol. Its IUPAC name is (3S,4S)-4-methyl-N-(3-methylcyclobutyl)-1,1-dioxothiolan-3-amine.
Molecular Properties
| Compound Name | (3S,4S)-4-methyl-N-(3-methylcyclobutyl)-1,1-dioxothiolan-3-amine |
| PubChem CID | 131002770 |
| Molecular Formula | C10H19NO2S |
| Molecular Weight | 217.33 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | (3S,4S)-4-methyl-N-(3-methylcyclobutyl)-1,1-dioxothiolan-3-amine |
| SMILES | CC1CC(N[C@@H]2CS(=O)(=O)C[C@H]2C)C1 |
| InChI | InChI=1S/C10H19NO2S/c1-7-3-9(4-7)11-10-6-14(12,13)5-8(10)2/h7-11H,3-6H2,1-2H3/t7?,8-,9?,10-/m1/s1 |
| InChIKey | BMXBHFLENYJURN-QLVNRRSVSA-N |
| XLogP | 0.81 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.33 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S,4S)-4-methyl-N-(3-methylcyclobutyl)-1,1-dioxothiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-4-methyl-N-(3-methylcyclobutyl)-1,1-dioxothiolan-3-amine?
The IUPAC name of (3S,4S)-4-methyl-N-(3-methylcyclobutyl)-1,1-dioxothiolan-3-amine (CID 131002770) is (3S,4S)-4-methyl-N-(3-methylcyclobutyl)-1,1-dioxothiolan-3-amine.
What is the SMILES notation for (3S,4S)-4-methyl-N-(3-methylcyclobutyl)-1,1-dioxothiolan-3-amine?
The canonical SMILES for (3S,4S)-4-methyl-N-(3-methylcyclobutyl)-1,1-dioxothiolan-3-amine is CC1CC(N[C@@H]2CS(=O)(=O)C[C@H]2C)C1.
What is the InChIKey of (3S,4S)-4-methyl-N-(3-methylcyclobutyl)-1,1-dioxothiolan-3-amine?
The InChIKey is BMXBHFLENYJURN-QLVNRRSVSA-N. The full InChI is InChI=1S/C10H19NO2S/c1-7-3-9(4-7)11-10-6-14(12,13)5-8(10)2/h7-11H,3-6H2,1-2H3/t7?,8-,9?,10-/m1/s1.
What are the key properties of (3S,4S)-4-methyl-N-(3-methylcyclobutyl)-1,1-dioxothiolan-3-amine?
(3S,4S)-4-methyl-N-(3-methylcyclobutyl)-1,1-dioxothiolan-3-amine has a molecular weight of 217.33 g/mol, XLogP of 0.81, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-4-methyl-N-(3-methylcyclobutyl)-1,1-dioxothiolan-3-amine is sourced from PubChem (CID 131002770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).