C12H23NO2S — CID 63993922
N-(2,4-dimethylcyclohexyl)-1,1-dioxothiolan-3-amine (PubChem CID 63993922) has the molecular formula C12H23NO2S and a molecular weight of 245.39 g/mol. Its IUPAC name is N-(2,4-dimethylcyclohexyl)-1,1-dioxothiolan-3-amine.
| Compound Name | N-(2,4-dimethylcyclohexyl)-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 63993922 |
| Molecular Formula | C12H23NO2S |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | N-(2,4-dimethylcyclohexyl)-1,1-dioxothiolan-3-amine |
| SMILES | CC1CCC(NC2CCS(=O)(=O)C2)C(C)C1 |
| InChI | InChI=1S/C12H23NO2S/c1-9-3-4-12(10(2)7-9)13-11-5-6-16(14,15)8-11/h9-13H,3-8H2,1-2H3 |
| InChIKey | FHXYKFXYRVCNEC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |