C10H20N2O2S — CID 81300872
N-(1,1-dioxothiolan-3-yl)-1,5-dimethylpyrrolidin-3-amine (PubChem CID 81300872) has the molecular formula C10H20N2O2S and a molecular weight of 232.35 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-1,5-dimethylpyrrolidin-3-amine.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-1,5-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 81300872 |
| Molecular Formula | C10H20N2O2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-1,5-dimethylpyrrolidin-3-amine |
| SMILES | CC1CC(NC2CCS(=O)(=O)C2)CN1C |
| InChI | InChI=1S/C10H20N2O2S/c1-8-5-10(6-12(8)2)11-9-3-4-15(13,14)7-9/h8-11H,3-7H2,1-2H3 |
| InChIKey | VKCBSIHQWDQISX-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |