C5H8N4O4S — CID 131007644
2-[(4-methyl-1,2,4-triazol-3-yl)sulfamoyl]acetic acid (PubChem CID 131007644) has the molecular formula C5H8N4O4S and a molecular weight of 220.21 g/mol. Its IUPAC name is 2-[(4-methyl-1,2,4-triazol-3-yl)sulfamoyl]acetic acid.
| Compound Name | 2-[(4-methyl-1,2,4-triazol-3-yl)sulfamoyl]acetic acid |
|---|---|
| PubChem CID | 131007644 |
| Molecular Formula | C5H8N4O4S |
| Molecular Weight | 220.21 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | 2-[(4-methyl-1,2,4-triazol-3-yl)sulfamoyl]acetic acid |
| SMILES | Cn1cnnc1NS(=O)(=O)CC(=O)O |
| InChI | InChI=1S/C5H8N4O4S/c1-9-3-6-7-5(9)8-14(12,13)2-4(10)11/h3H,2H2,1H3,(H,7,8)(H,10,11) |
| InChIKey | VGGXBVOVAWACLW-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.21 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |