C10H14O2 — CID 131007710
(3aS,7aS)-7a-hydroxy-3a-methyl-3,5,6,7-tetrahydroinden-4-one (PubChem CID 131007710) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is (3aS,7aS)-7a-hydroxy-3a-methyl-3,5,6,7-tetrahydroinden-4-one.
| Compound Name | (3aS,7aS)-7a-hydroxy-3a-methyl-3,5,6,7-tetrahydroinden-4-one |
|---|---|
| PubChem CID | 131007710 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (3aS,7aS)-7a-hydroxy-3a-methyl-3,5,6,7-tetrahydroinden-4-one |
| SMILES | C[C@]12CC=C[C@@]1(O)CCCC2=O |
| InChI | InChI=1S/C10H14O2/c1-9-5-3-7-10(9,12)6-2-4-8(9)11/h3,7,12H,2,4-6H2,1H3/t9-,10+/m1/s1 |
| InChIKey | RLNSUJKSUKZKGC-ZJUUUORDSA-N |
| XLogP | 1.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|