C7H13NO — CID 131014550
[(2S,3S)-3-prop-2-enylazetidin-2-yl]methanol (PubChem CID 131014550) has the molecular formula C7H13NO and a molecular weight of 127.19 g/mol. Its IUPAC name is [(2S,3S)-3-prop-2-enylazetidin-2-yl]methanol.
| Compound Name | [(2S,3S)-3-prop-2-enylazetidin-2-yl]methanol |
|---|---|
| PubChem CID | 131014550 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | [(2S,3S)-3-prop-2-enylazetidin-2-yl]methanol |
| SMILES | C=CC[C@H]1CN[C@@H]1CO |
| InChI | InChI=1S/C7H13NO/c1-2-3-6-4-8-7(6)5-9/h2,6-9H,1,3-5H2/t6-,7+/m0/s1 |
| InChIKey | NCCDXSNGXWGIHK-NKWVEPMBSA-N |
| XLogP | 0.14 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|