C7H12ClNO — CID 170918285
[(1S,2R,5R)-3-azabicyclo[3.2.0]hept-6-en-2-yl]methanol;hydrochloride (PubChem CID 170918285) has the molecular formula C7H12ClNO and a molecular weight of 161.63 g/mol. Its IUPAC name is [(1S,2R,5R)-3-azabicyclo[3.2.0]hept-6-en-2-yl]methanol;hydrochloride.
| Compound Name | [(1S,2R,5R)-3-azabicyclo[3.2.0]hept-6-en-2-yl]methanol;hydrochloride |
|---|---|
| PubChem CID | 170918285 |
| Molecular Formula | C7H12ClNO |
| Molecular Weight | 161.63 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | [(1S,2R,5R)-3-azabicyclo[3.2.0]hept-6-en-2-yl]methanol;hydrochloride |
| SMILES | Cl.OC[C@@H]1NC[C@@H]2C=C[C@H]12 |
| InChI | InChI=1S/C7H11NO.ClH/c9-4-7-6-2-1-5(6)3-8-7;/h1-2,5-9H,3-4H2;1H/t5-,6-,7-;/m0./s1 |
| InChIKey | DGIWMVSLVAVIEH-MKXDVQRUSA-N |
| XLogP | 0.17 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.63 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|