C9H16N4S — CID 131014603
5-(2-propylpyrrolidin-1-yl)-1,2,4-thiadiazol-3-amine (PubChem CID 131014603) has the molecular formula C9H16N4S and a molecular weight of 212.32 g/mol. Its IUPAC name is 5-(2-propylpyrrolidin-1-yl)-1,2,4-thiadiazol-3-amine.
| Compound Name | 5-(2-propylpyrrolidin-1-yl)-1,2,4-thiadiazol-3-amine |
|---|---|
| PubChem CID | 131014603 |
| Molecular Formula | C9H16N4S |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 5-(2-propylpyrrolidin-1-yl)-1,2,4-thiadiazol-3-amine |
| SMILES | CCCC1CCCN1c1nc(N)ns1 |
| InChI | InChI=1S/C9H16N4S/c1-2-4-7-5-3-6-13(7)9-11-8(10)12-14-9/h7H,2-6H2,1H3,(H2,10,12) |
| InChIKey | WIRRHEOEHUXEKQ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |