C15H19ClN4O — CID 13103108
2-chloro-N-(2,6-dimethylphenyl)-N-[(2,5-dimethyl-1,2,4-triazol-3-yl)methyl]acetamide (PubChem CID 13103108) has the molecular formula C15H19ClN4O and a molecular weight of 306.80 g/mol. Its IUPAC name is 2-chloro-N-(2,6-dimethylphenyl)-N-[(2,5-dimethyl-1,2,4-triazol-3-yl)methyl]acetamide.
| Compound Name | 2-chloro-N-(2,6-dimethylphenyl)-N-[(2,5-dimethyl-1,2,4-triazol-3-yl)methyl]acetamide |
|---|---|
| PubChem CID | 13103108 |
| Molecular Formula | C15H19ClN4O |
| Molecular Weight | 306.80 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 2-chloro-N-(2,6-dimethylphenyl)-N-[(2,5-dimethyl-1,2,4-triazol-3-yl)methyl]acetamide |
| SMILES | Cc1nc(CN(C(=O)CCl)c2c(C)cccc2C)n(C)n1 |
| InChI | InChI=1S/C15H19ClN4O/c1-10-6-5-7-11(2)15(10)20(14(21)8-16)9-13-17-12(3)18-19(13)4/h5-7H,8-9H2,1-4H3 |
| InChIKey | RJTQNSZWHPWFOX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.80 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|