C9H10N2S2 — CID 131031250
6-methylsulfanyl-1-benzothiophene-2,3-diamine (PubChem CID 131031250) has the molecular formula C9H10N2S2 and a molecular weight of 210.33 g/mol. Its IUPAC name is 6-methylsulfanyl-1-benzothiophene-2,3-diamine.
| Compound Name | 6-methylsulfanyl-1-benzothiophene-2,3-diamine |
|---|---|
| PubChem CID | 131031250 |
| Molecular Formula | C9H10N2S2 |
| Molecular Weight | 210.33 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | 6-methylsulfanyl-1-benzothiophene-2,3-diamine |
| SMILES | CSc1ccc2c(N)c(N)sc2c1 |
| InChI | InChI=1S/C9H10N2S2/c1-12-5-2-3-6-7(4-5)13-9(11)8(6)10/h2-4H,10-11H2,1H3 |
| InChIKey | QCYPPZCYIWEEBW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.33 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |