C7H8O2 — CID 131046087
(1S,4S)-7-oxabicyclo[2.2.1]hept-5-ene-2-carbaldehyde (PubChem CID 131046087) has the molecular formula C7H8O2 and a molecular weight of 124.14 g/mol. Its IUPAC name is (1S,4S)-7-oxabicyclo[2.2.1]hept-5-ene-2-carbaldehyde.
| Compound Name | (1S,4S)-7-oxabicyclo[2.2.1]hept-5-ene-2-carbaldehyde |
|---|---|
| PubChem CID | 131046087 |
| Molecular Formula | C7H8O2 |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.05 |
| IUPAC Name | (1S,4S)-7-oxabicyclo[2.2.1]hept-5-ene-2-carbaldehyde |
| SMILES | O=CC1C[C@H]2C=C[C@@H]1O2 |
| InChI | InChI=1S/C7H8O2/c8-4-5-3-6-1-2-7(5)9-6/h1-2,4-7H,3H2/t5?,6-,7+/m1/s1 |
| InChIKey | HNZKTZQAZFYSAX-FWPZAIACSA-N |
| XLogP | 0.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|