C9H10O2 — CID 11389481
(2R,3aR,6aR)-2-ethenyl-2,3,3a,6a-tetrahydrocyclopenta[b]furan-4-one (PubChem CID 11389481) has the molecular formula C9H10O2 and a molecular weight of 150.18 g/mol. Its IUPAC name is (2R,3aR,6aR)-2-ethenyl-2,3,3a,6a-tetrahydrocyclopenta[b]furan-4-one.
| Compound Name | (2R,3aR,6aR)-2-ethenyl-2,3,3a,6a-tetrahydrocyclopenta[b]furan-4-one |
|---|---|
| PubChem CID | 11389481 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | (2R,3aR,6aR)-2-ethenyl-2,3,3a,6a-tetrahydrocyclopenta[b]furan-4-one |
| SMILES | C=C[C@H]1C[C@H]2C(=O)C=C[C@H]2O1 |
| InChI | InChI=1S/C9H10O2/c1-2-6-5-7-8(10)3-4-9(7)11-6/h2-4,6-7,9H,1,5H2/t6-,7-,9+/m0/s1 |
| InChIKey | JCKUDRNEYGOUHA-ACLDMZEESA-N |
| XLogP | 1.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|