C20H24O5S — CID 13105345
(5R,6R)-6-(benzenesulfonyl)-5-hydroxy-8-phenyloctanoic acid (PubChem CID 13105345) has the molecular formula C20H24O5S and a molecular weight of 376.47 g/mol. Its IUPAC name is (5R,6R)-6-(benzenesulfonyl)-5-hydroxy-8-phenyloctanoic acid.
| Compound Name | (5R,6R)-6-(benzenesulfonyl)-5-hydroxy-8-phenyloctanoic acid |
|---|---|
| PubChem CID | 13105345 |
| Molecular Formula | C20H24O5S |
| Molecular Weight | 376.47 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | (5R,6R)-6-(benzenesulfonyl)-5-hydroxy-8-phenyloctanoic acid |
| SMILES | O=C(O)CCC[C@@H](O)[C@@H](CCc1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H24O5S/c21-18(12-7-13-20(22)23)19(15-14-16-8-3-1-4-9-16)26(24,25)17-10-5-2-6-11-17/h1-6,8-11,18-19,21H,7,12-15H2,(H,22,23)/t18-,19-/m1/s1 |
| InChIKey | TYJGKUCPHAYBMT-RTBURBONSA-N |
| XLogP | 3.08 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.47 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |