C10H9IO2S — CID 131053482
6-iodo-3,4-dimethoxy-1-benzothiophene (PubChem CID 131053482) has the molecular formula C10H9IO2S and a molecular weight of 320.15 g/mol. Its IUPAC name is 6-iodo-3,4-dimethoxy-1-benzothiophene.
| Compound Name | 6-iodo-3,4-dimethoxy-1-benzothiophene |
|---|---|
| PubChem CID | 131053482 |
| Molecular Formula | C10H9IO2S |
| Molecular Weight | 320.15 g/mol |
| Exact Mass | 319.94 |
| IUPAC Name | 6-iodo-3,4-dimethoxy-1-benzothiophene |
| SMILES | COc1csc2cc(I)cc(OC)c12 |
| InChI | InChI=1S/C10H9IO2S/c1-12-7-3-6(11)4-9-10(7)8(13-2)5-14-9/h3-5H,1-2H3 |
| InChIKey | KLYWFUCULFWBDM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.15 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|