C9H6I2S — CID 130805281
3,6-diiodo-4-methyl-1-benzothiophene (PubChem CID 130805281) has the molecular formula C9H6I2S and a molecular weight of 400.02 g/mol. Its IUPAC name is 3,6-diiodo-4-methyl-1-benzothiophene.
| Compound Name | 3,6-diiodo-4-methyl-1-benzothiophene |
|---|---|
| PubChem CID | 130805281 |
| Molecular Formula | C9H6I2S |
| Molecular Weight | 400.02 g/mol |
| Exact Mass | 399.83 |
| IUPAC Name | 3,6-diiodo-4-methyl-1-benzothiophene |
| SMILES | Cc1cc(I)cc2scc(I)c12 |
| InChI | InChI=1S/C9H6I2S/c1-5-2-6(10)3-8-9(5)7(11)4-12-8/h2-4H,1H3 |
| InChIKey | UKCMATWSIZXLIJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.02 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|