C10H9FS — CID 130956380
3-fluoro-4,6-dimethyl-1-benzothiophene (PubChem CID 130956380) has the molecular formula C10H9FS and a molecular weight of 180.25 g/mol. Its IUPAC name is 3-fluoro-4,6-dimethyl-1-benzothiophene.
| Compound Name | 3-fluoro-4,6-dimethyl-1-benzothiophene |
|---|---|
| PubChem CID | 130956380 |
| Molecular Formula | C10H9FS |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | 3-fluoro-4,6-dimethyl-1-benzothiophene |
| SMILES | Cc1cc(C)c2c(F)csc2c1 |
| InChI | InChI=1S/C10H9FS/c1-6-3-7(2)10-8(11)5-12-9(10)4-6/h3-5H,1-2H3 |
| InChIKey | KVAQOAVPRZPIBO-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |