C7H5FS2 — CID 129149047
5-fluoro-3-methylthieno[3,2-b]thiophene (PubChem CID 129149047) has the molecular formula C7H5FS2 and a molecular weight of 172.25 g/mol. Its IUPAC name is 5-fluoro-3-methylthieno[3,2-b]thiophene.
| Compound Name | 5-fluoro-3-methylthieno[3,2-b]thiophene |
|---|---|
| PubChem CID | 129149047 |
| Molecular Formula | C7H5FS2 |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 171.98 |
| IUPAC Name | 5-fluoro-3-methylthieno[3,2-b]thiophene |
| SMILES | Cc1csc2cc(F)sc12 |
| InChI | InChI=1S/C7H5FS2/c1-4-3-9-5-2-6(8)10-7(4)5/h2-3H,1H3 |
| InChIKey | XXHYIQMLMLRHGH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |