C9H6Cl2S — CID 91881908
4,7-dichloro-3-methyl-1-benzothiophene (PubChem CID 91881908) has the molecular formula C9H6Cl2S and a molecular weight of 217.12 g/mol. Its IUPAC name is 4,7-dichloro-3-methyl-1-benzothiophene.
| Compound Name | 4,7-dichloro-3-methyl-1-benzothiophene |
|---|---|
| PubChem CID | 91881908 |
| Molecular Formula | C9H6Cl2S |
| Molecular Weight | 217.12 g/mol |
| Exact Mass | 215.96 |
| IUPAC Name | 4,7-dichloro-3-methyl-1-benzothiophene |
| SMILES | Cc1csc2c(Cl)ccc(Cl)c12 |
| InChI | InChI=1S/C9H6Cl2S/c1-5-4-12-9-7(11)3-2-6(10)8(5)9/h2-4H,1H3 |
| InChIKey | FJCNOAAHCCPURI-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.12 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |