C9H5BrCl2S — CID 91881957
3-(bromomethyl)-4,7-dichloro-1-benzothiophene (PubChem CID 91881957) has the molecular formula C9H5BrCl2S and a molecular weight of 296.02 g/mol. Its IUPAC name is 3-(bromomethyl)-4,7-dichloro-1-benzothiophene.
| Compound Name | 3-(bromomethyl)-4,7-dichloro-1-benzothiophene |
|---|---|
| PubChem CID | 91881957 |
| Molecular Formula | C9H5BrCl2S |
| Molecular Weight | 296.02 g/mol |
| Exact Mass | 293.87 |
| IUPAC Name | 3-(bromomethyl)-4,7-dichloro-1-benzothiophene |
| SMILES | Clc1ccc(Cl)c2c(CBr)csc12 |
| InChI | InChI=1S/C9H5BrCl2S/c10-3-5-4-13-9-7(12)2-1-6(11)8(5)9/h1-2,4H,3H2 |
| InChIKey | RSSKPCGYPYMDGP-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.02 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|