2-amino-2-(3-methoxy-1,2-thiazol-5-yl)acetic acid

C6H8N2O3S — CID 131062450

IUPAC2-amino-2-(3-methoxy-1,2-thiazol-5-yl)acetic acid
SMILESCOc1cc(C(N)C(=O)O)sn1
InChIInChI=1S/C6H8N2O3S/c1-11-4-2-3(12-8-4)5(7)6(9)10/h2,5H,7H2,1H3,(H,9,10)
InChIKeyOATMMYNTWBBZOP-UHFFFAOYSA-N
MW188.21 g/mol
LogP0.24
Rot. Bonds3

About 2-amino-2-(3-methoxy-1,2-thiazol-5-yl)acetic acid

2-amino-2-(3-methoxy-1,2-thiazol-5-yl)acetic acid (PubChem CID 131062450) has the molecular formula C6H8N2O3S and a molecular weight of 188.21 g/mol. Its IUPAC name is 2-amino-2-(3-methoxy-1,2-thiazol-5-yl)acetic acid.

Molecular Properties

Compound Name2-amino-2-(3-methoxy-1,2-thiazol-5-yl)acetic acid
PubChem CID131062450
Molecular FormulaC6H8N2O3S
Molecular Weight188.21 g/mol
Exact Mass188.03
IUPAC Name2-amino-2-(3-methoxy-1,2-thiazol-5-yl)acetic acid
SMILESCOc1cc(C(N)C(=O)O)sn1
InChIInChI=1S/C6H8N2O3S/c1-11-4-2-3(12-8-4)5(7)6(9)10/h2,5H,7H2,1H3,(H,9,10)
InChIKeyOATMMYNTWBBZOP-UHFFFAOYSA-N
XLogP0.24
TPSA85.44 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500188.21
LogP ≤ 50.24
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-amino-2-(3-methoxy-1,2-thiazol-5-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2,2-Difluoro-2-(3-methoxy-1,2-thiazol-5-yl)acetic acid
CID 127020002
2-Fluoro-2-(3-methoxy-1,2-thiazol-5-yl)acetic acid
CID 131026745
2-(3-Methoxy-1,2-thiazol-5-yl)propanoic acid
CID 130656082
2-Amino-2-(3-methoxy-1,2-thiazol-5-yl)acetamide
CID 130855986
2-Amino-2-(3-methoxy-1,2-thiazol-5-yl)ethanol
CID 130914021
2-(3-Methoxy-1,2-thiazol-5-yl)-2-methylpropanoic acid
CID 131143340
2-(3-Methoxy-1,2-thiazol-5-yl)acetic acid
CID 131143595
(3S)-3-amino-3-(3-methoxy-1,2-thiazol-5-yl)propanoic acid
CID 165506073
3-Amino-3-(3-methoxy-1,2-thiazol-5-yl)propanoic acid
CID 165506904
(2S)-2-amino-3-(3-methoxy-1,2-thiazol-5-yl)propanoic acid
CID 165509059
(2R)-2-amino-3-(3-methoxy-1,2-thiazol-5-yl)propanoic acid
CID 165721937
2-Amino-3-(3-methoxy-1,2-thiazol-5-yl)propanoic acid
CID 165790880

Frequently Asked Questions

What is the IUPAC name of 2-amino-2-(3-methoxy-1,2-thiazol-5-yl)acetic acid?
The IUPAC name of 2-amino-2-(3-methoxy-1,2-thiazol-5-yl)acetic acid (CID 131062450) is 2-amino-2-(3-methoxy-1,2-thiazol-5-yl)acetic acid.
What is the SMILES notation for 2-amino-2-(3-methoxy-1,2-thiazol-5-yl)acetic acid?
The canonical SMILES for 2-amino-2-(3-methoxy-1,2-thiazol-5-yl)acetic acid is COc1cc(C(N)C(=O)O)sn1.
What is the InChIKey of 2-amino-2-(3-methoxy-1,2-thiazol-5-yl)acetic acid?
The InChIKey is OATMMYNTWBBZOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O3S/c1-11-4-2-3(12-8-4)5(7)6(9)10/h2,5H,7H2,1H3,(H,9,10).
What are the key properties of 2-amino-2-(3-methoxy-1,2-thiazol-5-yl)acetic acid?
2-amino-2-(3-methoxy-1,2-thiazol-5-yl)acetic acid has a molecular weight of 188.21 g/mol, XLogP of 0.24, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-(3-methoxy-1,2-thiazol-5-yl)acetic acid is sourced from PubChem (CID 131062450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).