C12H20BrNO — CID 131067162
1-(4-azatricyclo[5.2.1.02,6]decan-4-yl)-3-bromopropan-2-ol (PubChem CID 131067162) has the molecular formula C12H20BrNO and a molecular weight of 274.20 g/mol. Its IUPAC name is 1-(4-azatricyclo[5.2.1.02,6]decan-4-yl)-3-bromopropan-2-ol.
| Compound Name | 1-(4-azatricyclo[5.2.1.02,6]decan-4-yl)-3-bromopropan-2-ol |
|---|---|
| PubChem CID | 131067162 |
| Molecular Formula | C12H20BrNO |
| Molecular Weight | 274.20 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 1-(4-azatricyclo[5.2.1.02,6]decan-4-yl)-3-bromopropan-2-ol |
| SMILES | OC(CBr)CN1CC2C3CCC(C3)C2C1 |
| InChI | InChI=1S/C12H20BrNO/c13-4-10(15)5-14-6-11-8-1-2-9(3-8)12(11)7-14/h8-12,15H,1-7H2 |
| InChIKey | STZFHGQDTKYMFE-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.20 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|