C8H15F2NS — CID 131067242
4-(2,2-difluoroethyl)-5-methyl-1,4-thiazepane (PubChem CID 131067242) has the molecular formula C8H15F2NS and a molecular weight of 195.28 g/mol. Its IUPAC name is 4-(2,2-difluoroethyl)-5-methyl-1,4-thiazepane.
| Compound Name | 4-(2,2-difluoroethyl)-5-methyl-1,4-thiazepane |
|---|---|
| PubChem CID | 131067242 |
| Molecular Formula | C8H15F2NS |
| Molecular Weight | 195.28 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 4-(2,2-difluoroethyl)-5-methyl-1,4-thiazepane |
| SMILES | CC1CCSCCN1CC(F)F |
| InChI | InChI=1S/C8H15F2NS/c1-7-2-4-12-5-3-11(7)6-8(9)10/h7-8H,2-6H2,1H3 |
| InChIKey | ZVMKRXLADZNMSM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |