C11H22FNS — CID 124881276
(5S)-4-(5-fluoropentyl)-5-methyl-1,4-thiazepane (PubChem CID 124881276) has the molecular formula C11H22FNS and a molecular weight of 219.37 g/mol. Its IUPAC name is (5S)-4-(5-fluoropentyl)-5-methyl-1,4-thiazepane.
| Compound Name | (5S)-4-(5-fluoropentyl)-5-methyl-1,4-thiazepane |
|---|---|
| PubChem CID | 124881276 |
| Molecular Formula | C11H22FNS |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | (5S)-4-(5-fluoropentyl)-5-methyl-1,4-thiazepane |
| SMILES | C[C@H]1CCSCCN1CCCCCF |
| InChI | InChI=1S/C11H22FNS/c1-11-5-9-14-10-8-13(11)7-4-2-3-6-12/h11H,2-10H2,1H3/t11-/m0/s1 |
| InChIKey | YOPNPUBWIPXRHN-NSHDSACASA-N |
| XLogP | 2.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|