C8H10N2O2 — CID 13106750
N-(2,6-dimethylphenyl)nitramide (PubChem CID 13106750) has the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)nitramide.
| Compound Name | N-(2,6-dimethylphenyl)nitramide |
|---|---|
| PubChem CID | 13106750 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | N-(2,6-dimethylphenyl)nitramide |
| SMILES | Cc1cccc(C)c1N[N+](=O)[O-] |
| InChI | InChI=1S/C8H10N2O2/c1-6-4-3-5-7(2)8(6)9-10(11)12/h3-5,9H,1-2H3 |
| InChIKey | ZOXNBNMGIZLWNA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|