C7H9N3O2 — CID 174290384
N-(3,4-dimethyl-2-pyridinyl)nitramide (PubChem CID 174290384) has the molecular formula C7H9N3O2 and a molecular weight of 167.17 g/mol. Its IUPAC name is N-(3,4-dimethyl-2-pyridinyl)nitramide.
| Compound Name | N-(3,4-dimethyl-2-pyridinyl)nitramide |
|---|---|
| PubChem CID | 174290384 |
| Molecular Formula | C7H9N3O2 |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | N-(3,4-dimethyl-2-pyridinyl)nitramide |
| SMILES | Cc1ccnc(N[N+](=O)[O-])c1C |
| InChI | InChI=1S/C7H9N3O2/c1-5-3-4-8-7(6(5)2)9-10(11)12/h3-4H,1-2H3,(H,8,9) |
| InChIKey | RZQJZKJXRNTFCF-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|