C11H23ClN2 — CID 131067525
3-(2,5-dimethylpyrrolidin-1-yl)piperidine;hydrochloride (PubChem CID 131067525) has the molecular formula C11H23ClN2 and a molecular weight of 218.77 g/mol. Its IUPAC name is 3-(2,5-dimethylpyrrolidin-1-yl)piperidine;hydrochloride.
| Compound Name | 3-(2,5-dimethylpyrrolidin-1-yl)piperidine;hydrochloride |
|---|---|
| PubChem CID | 131067525 |
| Molecular Formula | C11H23ClN2 |
| Molecular Weight | 218.77 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 3-(2,5-dimethylpyrrolidin-1-yl)piperidine;hydrochloride |
| SMILES | CC1CCC(C)N1C1CCCNC1.Cl |
| InChI | InChI=1S/C11H22N2.ClH/c1-9-5-6-10(2)13(9)11-4-3-7-12-8-11;/h9-12H,3-8H2,1-2H3;1H |
| InChIKey | PHIARRCENDQKKP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.77 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |