C9H12Cl2N2O — CID 131067653
(2S)-4-[(3,6-dichloro-2-pyridinyl)amino]butan-2-ol (PubChem CID 131067653) has the molecular formula C9H12Cl2N2O and a molecular weight of 235.11 g/mol. Its IUPAC name is (2S)-4-[(3,6-dichloro-2-pyridinyl)amino]butan-2-ol.
| Compound Name | (2S)-4-[(3,6-dichloro-2-pyridinyl)amino]butan-2-ol |
|---|---|
| PubChem CID | 131067653 |
| Molecular Formula | C9H12Cl2N2O |
| Molecular Weight | 235.11 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | (2S)-4-[(3,6-dichloro-2-pyridinyl)amino]butan-2-ol |
| SMILES | C[C@H](O)CCNc1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C9H12Cl2N2O/c1-6(14)4-5-12-9-7(10)2-3-8(11)13-9/h2-3,6,14H,4-5H2,1H3,(H,12,13)/t6-/m0/s1 |
| InChIKey | RHOWWHHFZWEEFA-LURJTMIESA-N |
| XLogP | 2.57 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.11 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|