About (6R)-6-hydroxydeca-2,8-diyn-4-one
(6R)-6-hydroxydeca-2,8-diyn-4-one (PubChem CID 131071219) has the molecular formula C10H12O2
and a molecular weight of 164.20 g/mol. Its IUPAC name is (6R)-6-hydroxydeca-2,8-diyn-4-one.
Molecular Properties
| Compound Name | (6R)-6-hydroxydeca-2,8-diyn-4-one |
| PubChem CID | 131071219 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | (6R)-6-hydroxydeca-2,8-diyn-4-one |
| SMILES | CC#CC[C@@H](O)CC(=O)C#CC |
| InChI | InChI=1S/C10H12O2/c1-3-5-7-10(12)8-9(11)6-4-2/h10,12H,7-8H2,1-2H3/t10-/m1/s1 |
| InChIKey | YRESBLAHRQTJLM-SNVBAGLBSA-N |
| XLogP | 0.74 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (6R)-6-hydroxydeca-2,8-diyn-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-6-hydroxydeca-2,8-diyn-4-one?
The IUPAC name of (6R)-6-hydroxydeca-2,8-diyn-4-one (CID 131071219) is (6R)-6-hydroxydeca-2,8-diyn-4-one.
What is the SMILES notation for (6R)-6-hydroxydeca-2,8-diyn-4-one?
The canonical SMILES for (6R)-6-hydroxydeca-2,8-diyn-4-one is CC#CC[C@@H](O)CC(=O)C#CC.
What is the InChIKey of (6R)-6-hydroxydeca-2,8-diyn-4-one?
The InChIKey is YRESBLAHRQTJLM-SNVBAGLBSA-N. The full InChI is InChI=1S/C10H12O2/c1-3-5-7-10(12)8-9(11)6-4-2/h10,12H,7-8H2,1-2H3/t10-/m1/s1.
What are the key properties of (6R)-6-hydroxydeca-2,8-diyn-4-one?
(6R)-6-hydroxydeca-2,8-diyn-4-one has a molecular weight of 164.20 g/mol, XLogP of 0.74, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-6-hydroxydeca-2,8-diyn-4-one is sourced from PubChem (CID 131071219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).