C7H12O2 — CID 131073665
3-oxabicyclo[4.1.0]heptan-6-ylmethanol (PubChem CID 131073665) has the molecular formula C7H12O2 and a molecular weight of 128.17 g/mol. Its IUPAC name is 3-oxabicyclo[4.1.0]heptan-6-ylmethanol.
| Compound Name | 3-oxabicyclo[4.1.0]heptan-6-ylmethanol |
|---|---|
| PubChem CID | 131073665 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | 3-oxabicyclo[4.1.0]heptan-6-ylmethanol |
| SMILES | OCC12CCOCC1C2 |
| InChI | InChI=1S/C7H12O2/c8-5-7-1-2-9-4-6(7)3-7/h6,8H,1-5H2 |
| InChIKey | YQJDBOOCKTUOIQ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |