C10H5Br2NS — CID 131076509
2-(4,6-dibromo-1-benzothiophen-5-yl)acetonitrile (PubChem CID 131076509) has the molecular formula C10H5Br2NS and a molecular weight of 331.03 g/mol. Its IUPAC name is 2-(4,6-dibromo-1-benzothiophen-5-yl)acetonitrile.
| Compound Name | 2-(4,6-dibromo-1-benzothiophen-5-yl)acetonitrile |
|---|---|
| PubChem CID | 131076509 |
| Molecular Formula | C10H5Br2NS |
| Molecular Weight | 331.03 g/mol |
| Exact Mass | 328.85 |
| IUPAC Name | 2-(4,6-dibromo-1-benzothiophen-5-yl)acetonitrile |
| SMILES | N#CCc1c(Br)cc2sccc2c1Br |
| InChI | InChI=1S/C10H5Br2NS/c11-8-5-9-7(2-4-14-9)10(12)6(8)1-3-13/h2,4-5H,1H2 |
| InChIKey | ZNVZBMBGLNHVKB-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.03 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |