C9H13NO2 — CID 131084146
azetidin-1-yl(3,4-dihydro-2H-pyran-5-yl)methanone (PubChem CID 131084146) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is azetidin-1-yl(3,4-dihydro-2H-pyran-5-yl)methanone.
| Compound Name | azetidin-1-yl(3,4-dihydro-2H-pyran-5-yl)methanone |
|---|---|
| PubChem CID | 131084146 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | azetidin-1-yl(3,4-dihydro-2H-pyran-5-yl)methanone |
| SMILES | O=C(C1=COCCC1)N1CCC1 |
| InChI | InChI=1S/C9H13NO2/c11-9(10-4-2-5-10)8-3-1-6-12-7-8/h7H,1-6H2 |
| InChIKey | FNZXQEHMYUNTIN-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |