About 1-(3,4-dihydro-2H-pyran-5-yl)-2-piperazin-1-ylethanone
1-(3,4-dihydro-2H-pyran-5-yl)-2-piperazin-1-ylethanone (PubChem CID 116559609) has the molecular formula C11H18N2O2
and a molecular weight of 210.28 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyran-5-yl)-2-piperazin-1-ylethanone.
Molecular Properties
| Compound Name | 1-(3,4-dihydro-2H-pyran-5-yl)-2-piperazin-1-ylethanone |
| PubChem CID | 116559609 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyran-5-yl)-2-piperazin-1-ylethanone |
| SMILES | O=C(CN1CCNCC1)C1=COCCC1 |
| InChI | InChI=1S/C11H18N2O2/c14-11(10-2-1-7-15-9-10)8-13-5-3-12-4-6-13/h9,12H,1-8H2 |
| InChIKey | CCOZKZHKTXNJCH-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3,4-dihydro-2H-pyran-5-yl)-2-piperazin-1-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dihydro-2H-pyran-5-yl)-2-piperazin-1-ylethanone?
The IUPAC name of 1-(3,4-dihydro-2H-pyran-5-yl)-2-piperazin-1-ylethanone (CID 116559609) is 1-(3,4-dihydro-2H-pyran-5-yl)-2-piperazin-1-ylethanone.
What is the SMILES notation for 1-(3,4-dihydro-2H-pyran-5-yl)-2-piperazin-1-ylethanone?
The canonical SMILES for 1-(3,4-dihydro-2H-pyran-5-yl)-2-piperazin-1-ylethanone is O=C(CN1CCNCC1)C1=COCCC1.
What is the InChIKey of 1-(3,4-dihydro-2H-pyran-5-yl)-2-piperazin-1-ylethanone?
The InChIKey is CCOZKZHKTXNJCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O2/c14-11(10-2-1-7-15-9-10)8-13-5-3-12-4-6-13/h9,12H,1-8H2.
What are the key properties of 1-(3,4-dihydro-2H-pyran-5-yl)-2-piperazin-1-ylethanone?
1-(3,4-dihydro-2H-pyran-5-yl)-2-piperazin-1-ylethanone has a molecular weight of 210.28 g/mol, XLogP of 0.16, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dihydro-2H-pyran-5-yl)-2-piperazin-1-ylethanone is sourced from PubChem (CID 116559609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).