C11H18N2O2 — CID 130579654
2-(1,4-diazepan-1-yl)-1-(2,3-dihydrofuran-4-yl)ethanone (PubChem CID 130579654) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-1-(2,3-dihydrofuran-4-yl)ethanone.
| Compound Name | 2-(1,4-diazepan-1-yl)-1-(2,3-dihydrofuran-4-yl)ethanone |
|---|---|
| PubChem CID | 130579654 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-1-(2,3-dihydrofuran-4-yl)ethanone |
| SMILES | O=C(CN1CCCNCC1)C1=COCC1 |
| InChI | InChI=1S/C11H18N2O2/c14-11(10-2-7-15-9-10)8-13-5-1-3-12-4-6-13/h9,12H,1-8H2 |
| InChIKey | GCYIMSIRAFQYNT-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |