C8H12N2 — CID 131084599
2-[(1S,6R)-2-azabicyclo[4.1.0]heptan-2-yl]acetonitrile (PubChem CID 131084599) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is 2-[(1S,6R)-2-azabicyclo[4.1.0]heptan-2-yl]acetonitrile.
| Compound Name | 2-[(1S,6R)-2-azabicyclo[4.1.0]heptan-2-yl]acetonitrile |
|---|---|
| PubChem CID | 131084599 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 2-[(1S,6R)-2-azabicyclo[4.1.0]heptan-2-yl]acetonitrile |
| SMILES | N#CCN1CCC[C@@H]2C[C@@H]21 |
| InChI | InChI=1S/C8H12N2/c9-3-5-10-4-1-2-7-6-8(7)10/h7-8H,1-2,4-6H2/t7-,8+/m1/s1 |
| InChIKey | FTKZUOSJWAYTRZ-SFYZADRCSA-N |
| XLogP | 0.99 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|