C9H13N — CID 130991319
(1S,6R)-2-prop-2-ynyl-2-azabicyclo[4.1.0]heptane (PubChem CID 130991319) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is (1S,6R)-2-prop-2-ynyl-2-azabicyclo[4.1.0]heptane.
| Compound Name | (1S,6R)-2-prop-2-ynyl-2-azabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 130991319 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | (1S,6R)-2-prop-2-ynyl-2-azabicyclo[4.1.0]heptane |
| SMILES | C#CCN1CCC[C@@H]2C[C@@H]21 |
| InChI | InChI=1S/C9H13N/c1-2-5-10-6-3-4-8-7-9(8)10/h1,8-9H,3-7H2/t8-,9+/m1/s1 |
| InChIKey | LQHGRHJUJNPBCO-BDAKNGLRSA-N |
| XLogP | 1.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|