About 2-(3,4-dihydro-2H-pyran-5-yl)-2-oxoacetic acid
2-(3,4-dihydro-2H-pyran-5-yl)-2-oxoacetic acid (PubChem CID 131089817) has the molecular formula C7H8O4
and a molecular weight of 156.14 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-pyran-5-yl)-2-oxoacetic acid.
Molecular Properties
| Compound Name | 2-(3,4-dihydro-2H-pyran-5-yl)-2-oxoacetic acid |
| PubChem CID | 131089817 |
| Molecular Formula | C7H8O4 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | 2-(3,4-dihydro-2H-pyran-5-yl)-2-oxoacetic acid |
| SMILES | O=C(O)C(=O)C1=COCCC1 |
| InChI | InChI=1S/C7H8O4/c8-6(7(9)10)5-2-1-3-11-4-5/h4H,1-3H2,(H,9,10) |
| InChIKey | QMUOGNWNUIHSQN-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,4-dihydro-2H-pyran-5-yl)-2-oxoacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dihydro-2H-pyran-5-yl)-2-oxoacetic acid?
The IUPAC name of 2-(3,4-dihydro-2H-pyran-5-yl)-2-oxoacetic acid (CID 131089817) is 2-(3,4-dihydro-2H-pyran-5-yl)-2-oxoacetic acid.
What is the SMILES notation for 2-(3,4-dihydro-2H-pyran-5-yl)-2-oxoacetic acid?
The canonical SMILES for 2-(3,4-dihydro-2H-pyran-5-yl)-2-oxoacetic acid is O=C(O)C(=O)C1=COCCC1.
What is the InChIKey of 2-(3,4-dihydro-2H-pyran-5-yl)-2-oxoacetic acid?
The InChIKey is QMUOGNWNUIHSQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O4/c8-6(7(9)10)5-2-1-3-11-4-5/h4H,1-3H2,(H,9,10).
What are the key properties of 2-(3,4-dihydro-2H-pyran-5-yl)-2-oxoacetic acid?
2-(3,4-dihydro-2H-pyran-5-yl)-2-oxoacetic acid has a molecular weight of 156.14 g/mol, XLogP of 0.33, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dihydro-2H-pyran-5-yl)-2-oxoacetic acid is sourced from PubChem (CID 131089817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).