C9H16N4 — CID 131089854
N,4,5-trimethyl-N-(2-methylprop-2-enyl)-1,2,4-triazol-3-amine (PubChem CID 131089854) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is N,4,5-trimethyl-N-(2-methylprop-2-enyl)-1,2,4-triazol-3-amine.
| Compound Name | N,4,5-trimethyl-N-(2-methylprop-2-enyl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 131089854 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | N,4,5-trimethyl-N-(2-methylprop-2-enyl)-1,2,4-triazol-3-amine |
| SMILES | C=C(C)CN(C)c1nnc(C)n1C |
| InChI | InChI=1S/C9H16N4/c1-7(2)6-12(4)9-11-10-8(3)13(9)5/h1,6H2,2-5H3 |
| InChIKey | UDNWMGXXRAWSIN-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|