C9H17N3 — CID 143209078
3,5-dimethyl-4-prop-2-enyl-1,2,4-triazole;ethane (PubChem CID 143209078) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is 3,5-dimethyl-4-prop-2-enyl-1,2,4-triazole;ethane.
| Compound Name | 3,5-dimethyl-4-prop-2-enyl-1,2,4-triazole;ethane |
|---|---|
| PubChem CID | 143209078 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | 3,5-dimethyl-4-prop-2-enyl-1,2,4-triazole;ethane |
| SMILES | C=CCn1c(C)nnc1C.CC |
| InChI | InChI=1S/C7H11N3.C2H6/c1-4-5-10-6(2)8-9-7(10)3;1-2/h4H,1,5H2,2-3H3;1-2H3 |
| InChIKey | JEMAOPPQRBFGAG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|