C8H9ClN2OS — CID 131091967
1-[(2-chlorothiophen-3-yl)methyl]imidazolidin-2-one (PubChem CID 131091967) has the molecular formula C8H9ClN2OS and a molecular weight of 216.69 g/mol. Its IUPAC name is 1-[(2-chlorothiophen-3-yl)methyl]imidazolidin-2-one.
| Compound Name | 1-[(2-chlorothiophen-3-yl)methyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 131091967 |
| Molecular Formula | C8H9ClN2OS |
| Molecular Weight | 216.69 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | 1-[(2-chlorothiophen-3-yl)methyl]imidazolidin-2-one |
| SMILES | O=C1NCCN1Cc1ccsc1Cl |
| InChI | InChI=1S/C8H9ClN2OS/c9-7-6(1-4-13-7)5-11-3-2-10-8(11)12/h1,4H,2-3,5H2,(H,10,12) |
| InChIKey | VRIKZQWZYDNLBD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.69 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |