C9H19N3 — CID 131097837
1,2-dimethyl-3-(4-methylpent-3-enyl)guanidine (PubChem CID 131097837) has the molecular formula C9H19N3 and a molecular weight of 169.27 g/mol. Its IUPAC name is 1,2-dimethyl-3-(4-methylpent-3-enyl)guanidine.
| Compound Name | 1,2-dimethyl-3-(4-methylpent-3-enyl)guanidine |
|---|---|
| PubChem CID | 131097837 |
| Molecular Formula | C9H19N3 |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.16 |
| IUPAC Name | 1,2-dimethyl-3-(4-methylpent-3-enyl)guanidine |
| SMILES | C/N=C(\NC)NCCC=C(C)C |
| InChI | InChI=1S/C9H19N3/c1-8(2)6-5-7-12-9(10-3)11-4/h6H,5,7H2,1-4H3,(H2,10,11,12) |
| InChIKey | FEQUTHYQSNHISA-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|