C9H14O4 — CID 131098213
1-[(4S,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-yn-1-ol (PubChem CID 131098213) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is 1-[(4S,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-yn-1-ol.
| Compound Name | 1-[(4S,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 131098213 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 1-[(4S,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-yn-1-ol |
| SMILES | C#CC(O)[C@@H]1OC(C)(C)O[C@@H]1CO |
| InChI | InChI=1S/C9H14O4/c1-4-6(11)8-7(5-10)12-9(2,3)13-8/h1,6-8,10-11H,5H2,2-3H3/t6?,7-,8+/m1/s1 |
| InChIKey | ALVGRZCPKAQNTF-VVXQKDJTSA-N |
| XLogP | -0.51 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|