C8H8Cl2FNO — CID 131102295
1-(2,3-dichloro-4-fluorophenyl)-N-methoxymethanamine (PubChem CID 131102295) has the molecular formula C8H8Cl2FNO and a molecular weight of 224.06 g/mol. Its IUPAC name is 1-(2,3-dichloro-4-fluorophenyl)-N-methoxymethanamine.
| Compound Name | 1-(2,3-dichloro-4-fluorophenyl)-N-methoxymethanamine |
|---|---|
| PubChem CID | 131102295 |
| Molecular Formula | C8H8Cl2FNO |
| Molecular Weight | 224.06 g/mol |
| Exact Mass | 223.00 |
| IUPAC Name | 1-(2,3-dichloro-4-fluorophenyl)-N-methoxymethanamine |
| SMILES | CONCc1ccc(F)c(Cl)c1Cl |
| InChI | InChI=1S/C8H8Cl2FNO/c1-13-12-4-5-2-3-6(11)8(10)7(5)9/h2-3,12H,4H2,1H3 |
| InChIKey | LIHIQCNQKRXISM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.06 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|