C7H12N2OS — CID 131107615
2-(dimethylamino)-1-(1,2-thiazol-3-yl)ethanol (PubChem CID 131107615) has the molecular formula C7H12N2OS and a molecular weight of 172.25 g/mol. Its IUPAC name is 2-(dimethylamino)-1-(1,2-thiazol-3-yl)ethanol.
| Compound Name | 2-(dimethylamino)-1-(1,2-thiazol-3-yl)ethanol |
|---|---|
| PubChem CID | 131107615 |
| Molecular Formula | C7H12N2OS |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 2-(dimethylamino)-1-(1,2-thiazol-3-yl)ethanol |
| SMILES | CN(C)CC(O)c1ccsn1 |
| InChI | InChI=1S/C7H12N2OS/c1-9(2)5-7(10)6-3-4-11-8-6/h3-4,7,10H,5H2,1-2H3 |
| InChIKey | PZLWTNQARHFXAX-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |