C11H19ClN2O — CID 131110722
(3S,4S)-N-cyclopent-3-en-1-yl-4-methylpyrrolidine-3-carboxamide;hydrochloride (PubChem CID 131110722) has the molecular formula C11H19ClN2O and a molecular weight of 230.74 g/mol. Its IUPAC name is (3S,4S)-N-cyclopent-3-en-1-yl-4-methylpyrrolidine-3-carboxamide;hydrochloride.
| Compound Name | (3S,4S)-N-cyclopent-3-en-1-yl-4-methylpyrrolidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 131110722 |
| Molecular Formula | C11H19ClN2O |
| Molecular Weight | 230.74 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | (3S,4S)-N-cyclopent-3-en-1-yl-4-methylpyrrolidine-3-carboxamide;hydrochloride |
| SMILES | C[C@@H]1CNC[C@H]1C(=O)NC1CC=CC1.Cl |
| InChI | InChI=1S/C11H18N2O.ClH/c1-8-6-12-7-10(8)11(14)13-9-4-2-3-5-9;/h2-3,8-10,12H,4-7H2,1H3,(H,13,14);1H/t8-,10-;/m1./s1 |
| InChIKey | BTBKRVVODQFBGO-GHXDPTCOSA-N |
| XLogP | 1.10 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.74 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|