C10H22N2S — CID 131114155
1,2,5-trimethyl-4-(2-methylsulfanylethyl)piperazine (PubChem CID 131114155) has the molecular formula C10H22N2S and a molecular weight of 202.37 g/mol. Its IUPAC name is 1,2,5-trimethyl-4-(2-methylsulfanylethyl)piperazine.
| Compound Name | 1,2,5-trimethyl-4-(2-methylsulfanylethyl)piperazine |
|---|---|
| PubChem CID | 131114155 |
| Molecular Formula | C10H22N2S |
| Molecular Weight | 202.37 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 1,2,5-trimethyl-4-(2-methylsulfanylethyl)piperazine |
| SMILES | CSCCN1CC(C)N(C)CC1C |
| InChI | InChI=1S/C10H22N2S/c1-9-8-12(5-6-13-4)10(2)7-11(9)3/h9-10H,5-8H2,1-4H3 |
| InChIKey | XCSOUBNAWNCFOE-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.37 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |